C16H23IN2 — CID 79546515
2-iodo-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79546515) has the molecular formula C16H23IN2 and a molecular weight of 370.28 g/mol. Its IUPAC name is 2-iodo-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 2-iodo-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79546515 |
| Molecular Formula | C16H23IN2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-iodo-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Ic1ccccc1NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C16H23IN2/c17-13-7-2-4-9-16(13)19-15-8-3-1-6-12(15)14-10-5-11-18-14/h2,4,7,9,12,14-15,18-19H,1,3,5-6,8,10-11H2 |
| InChIKey | AVTOITOMNRSMAS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|