C16H22BrFN2 — CID 79546354
5-bromo-2-fluoro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline (PubChem CID 79546354) has the molecular formula C16H22BrFN2 and a molecular weight of 341.27 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline.
| Compound Name | 5-bromo-2-fluoro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 79546354 |
| Molecular Formula | C16H22BrFN2 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 5-bromo-2-fluoro-N-(2-pyrrolidin-2-ylcyclohexyl)aniline |
| SMILES | Fc1ccc(Br)cc1NC1CCCCC1C1CCCN1 |
| InChI | InChI=1S/C16H22BrFN2/c17-11-7-8-13(18)16(10-11)20-15-5-2-1-4-12(15)14-6-3-9-19-14/h7-8,10,12,14-15,19-20H,1-6,9H2 |
| InChIKey | PWSJKCJZMYWCML-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |