C16H21F3N2 — CID 79537662
2,4,5-trifluoro-N-(2-piperidin-2-ylcyclopentyl)aniline (PubChem CID 79537662) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(2-piperidin-2-ylcyclopentyl)aniline.
| Compound Name | 2,4,5-trifluoro-N-(2-piperidin-2-ylcyclopentyl)aniline |
|---|---|
| PubChem CID | 79537662 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2,4,5-trifluoro-N-(2-piperidin-2-ylcyclopentyl)aniline |
| SMILES | Fc1cc(F)c(NC2CCCC2C2CCCCN2)cc1F |
| InChI | InChI=1S/C16H21F3N2/c17-11-8-13(19)16(9-12(11)18)21-15-6-3-4-10(15)14-5-1-2-7-20-14/h8-10,14-15,20-21H,1-7H2 |
| InChIKey | OZWSEPFGCGYGJE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|