C13H15BrCl2N2S — CID 107788670
1-(4-bromo-2,3-dichlorophenyl)-3-cyclohexylthiourea (PubChem CID 107788670) has the molecular formula C13H15BrCl2N2S and a molecular weight of 382.15 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-3-cyclohexylthiourea.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-3-cyclohexylthiourea |
|---|---|
| PubChem CID | 107788670 |
| Molecular Formula | C13H15BrCl2N2S |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-3-cyclohexylthiourea |
| SMILES | S=C(Nc1ccc(Br)c(Cl)c1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C13H15BrCl2N2S/c14-9-6-7-10(12(16)11(9)15)18-13(19)17-8-4-2-1-3-5-8/h6-8H,1-5H2,(H2,17,18,19) |
| InChIKey | URCPOKQMFDMRDE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|