C10H9BrCl2N2S — CID 104587626
1-(4-bromo-2,3-dichlorophenyl)-3-cyclopropylthiourea (PubChem CID 104587626) has the molecular formula C10H9BrCl2N2S and a molecular weight of 340.07 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-3-cyclopropylthiourea.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-3-cyclopropylthiourea |
|---|---|
| PubChem CID | 104587626 |
| Molecular Formula | C10H9BrCl2N2S |
| Molecular Weight | 340.07 g/mol |
| Exact Mass | 337.90 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-3-cyclopropylthiourea |
| SMILES | S=C(Nc1ccc(Br)c(Cl)c1Cl)NC1CC1 |
| InChI | InChI=1S/C10H9BrCl2N2S/c11-6-3-4-7(9(13)8(6)12)15-10(16)14-5-1-2-5/h3-5H,1-2H2,(H2,14,15,16) |
| InChIKey | IXIHECSGVLMJPC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.07 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|