C13H16Br2N2S — CID 107598629
1-cyclohexyl-3-(2,6-dibromophenyl)thiourea (PubChem CID 107598629) has the molecular formula C13H16Br2N2S and a molecular weight of 392.16 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,6-dibromophenyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(2,6-dibromophenyl)thiourea |
|---|---|
| PubChem CID | 107598629 |
| Molecular Formula | C13H16Br2N2S |
| Molecular Weight | 392.16 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | 1-cyclohexyl-3-(2,6-dibromophenyl)thiourea |
| SMILES | S=C(Nc1c(Br)cccc1Br)NC1CCCCC1 |
| InChI | InChI=1S/C13H16Br2N2S/c14-10-7-4-8-11(15)12(10)17-13(18)16-9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H2,16,17,18) |
| InChIKey | BKQLKVDEXICUAJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.16 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|