C14H17BrCl2N2 — CID 107787830
N-(4-bromo-2,3-dichlorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 107787830) has the molecular formula C14H17BrCl2N2 and a molecular weight of 364.11 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 107787830 |
| Molecular Formula | C14H17BrCl2N2 |
| Molecular Weight | 364.11 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | Clc1c(Br)ccc(NC2CCN3CCCC3C2)c1Cl |
| InChI | InChI=1S/C14H17BrCl2N2/c15-11-3-4-12(14(17)13(11)16)18-9-5-7-19-6-1-2-10(19)8-9/h3-4,9-10,18H,1-2,5-8H2 |
| InChIKey | IJGQOONPBSANJU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|