C12H18ClN5 — CID 112731021
4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-6-chloropyrimidine-2,4-diamine (PubChem CID 112731021) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-6-chloropyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-6-chloropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112731021 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-6-chloropyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NC2CCN3CCCC3C2)n1 |
| InChI | InChI=1S/C12H18ClN5/c13-10-7-11(17-12(14)16-10)15-8-3-5-18-4-1-2-9(18)6-8/h7-9H,1-6H2,(H3,14,15,16,17) |
| InChIKey | GYQLSTBSBZDGJT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |