C13H19N7 — CID 114785762
6-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-7H-purine-2,6-diamine (PubChem CID 114785762) has the molecular formula C13H19N7 and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-7H-purine-2,6-diamine.
| Compound Name | 6-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-7H-purine-2,6-diamine |
|---|---|
| PubChem CID | 114785762 |
| Molecular Formula | C13H19N7 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-7H-purine-2,6-diamine |
| SMILES | Nc1nc(NC2CCN3CCCC3C2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C13H19N7/c14-13-18-11-10(15-7-16-11)12(19-13)17-8-3-5-20-4-1-2-9(20)6-8/h7-9H,1-6H2,(H4,14,15,16,17,18,19) |
| InChIKey | LZVHWYJLPNWMDG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |