C15H21ClN4O — CID 107196417
5-amino-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-3-chlorobenzamide (PubChem CID 107196417) has the molecular formula C15H21ClN4O and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-amino-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-3-chlorobenzamide.
| Compound Name | 5-amino-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-3-chlorobenzamide |
|---|---|
| PubChem CID | 107196417 |
| Molecular Formula | C15H21ClN4O |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-amino-2-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-3-chlorobenzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C15H21ClN4O/c16-13-7-9(17)6-12(15(18)21)14(13)19-10-3-5-20-4-1-2-11(20)8-10/h6-7,10-11,19H,1-5,8,17H2,(H2,18,21) |
| InChIKey | KUDFCJVLHZWXTE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|