C14H19ClN4O — CID 107195201
5-amino-3-chloro-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzamide (PubChem CID 107195201) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 5-amino-3-chloro-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzamide.
| Compound Name | 5-amino-3-chloro-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzamide |
|---|---|
| PubChem CID | 107195201 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-amino-3-chloro-2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1NC1CCN2CCCC12 |
| InChI | InChI=1S/C14H19ClN4O/c15-10-7-8(16)6-9(14(17)20)13(10)18-11-3-5-19-4-1-2-12(11)19/h6-7,11-12,18H,1-5,16H2,(H2,17,20) |
| InChIKey | PHBAQAIHCIXEJR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|