C13H15Cl3N2 — CID 82853439
N-(2,4,5-trichlorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine (PubChem CID 82853439) has the molecular formula C13H15Cl3N2 and a molecular weight of 305.64 g/mol. Its IUPAC name is N-(2,4,5-trichlorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine.
| Compound Name | N-(2,4,5-trichlorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
|---|---|
| PubChem CID | 82853439 |
| Molecular Formula | C13H15Cl3N2 |
| Molecular Weight | 305.64 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(2,4,5-trichlorophenyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-amine |
| SMILES | Clc1cc(Cl)c(NC2CCN3CCCC23)cc1Cl |
| InChI | InChI=1S/C13H15Cl3N2/c14-8-6-10(16)12(7-9(8)15)17-11-3-5-18-4-1-2-13(11)18/h6-7,11,13,17H,1-5H2 |
| InChIKey | UOZOBFQQAWCKFF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|