C10H10Cl3N — CID 168512071
1-(2,4,5-trichlorophenyl)pyrrolidine (PubChem CID 168512071) has the molecular formula C10H10Cl3N and a molecular weight of 250.56 g/mol. Its IUPAC name is 1-(2,4,5-trichlorophenyl)pyrrolidine.
| Compound Name | 1-(2,4,5-trichlorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 168512071 |
| Molecular Formula | C10H10Cl3N |
| Molecular Weight | 250.56 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 1-(2,4,5-trichlorophenyl)pyrrolidine |
| SMILES | Clc1cc(Cl)c(N2CCCC2)cc1Cl |
| InChI | InChI=1S/C10H10Cl3N/c11-7-5-9(13)10(6-8(7)12)14-3-1-2-4-14/h5-6H,1-4H2 |
| InChIKey | KINHIYJLQSVTFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|