C15H19Cl3N2 — CID 64943180
3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane (PubChem CID 64943180) has the molecular formula C15H19Cl3N2 and a molecular weight of 333.69 g/mol. Its IUPAC name is 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane.
| Compound Name | 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64943180 |
| Molecular Formula | C15H19Cl3N2 |
| Molecular Weight | 333.69 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 3-cyclopropyl-3-methyl-1-(2,4,5-trichlorophenyl)-1,4-diazepane |
| SMILES | CC1(C2CC2)CN(c2cc(Cl)c(Cl)cc2Cl)CCCN1 |
| InChI | InChI=1S/C15H19Cl3N2/c1-15(10-3-4-10)9-20(6-2-5-19-15)14-8-12(17)11(16)7-13(14)18/h7-8,10,19H,2-6,9H2,1H3 |
| InChIKey | OXABFHLWNPTGIM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|