C17H26N2 — CID 64943908
3-cyclopropyl-1-(3,5-dimethylphenyl)-3-methyl-1,4-diazepane (PubChem CID 64943908) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-cyclopropyl-1-(3,5-dimethylphenyl)-3-methyl-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-(3,5-dimethylphenyl)-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 64943908 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-cyclopropyl-1-(3,5-dimethylphenyl)-3-methyl-1,4-diazepane |
| SMILES | Cc1cc(C)cc(N2CCCNC(C)(C3CC3)C2)c1 |
| InChI | InChI=1S/C17H26N2/c1-13-9-14(2)11-16(10-13)19-8-4-7-18-17(3,12-19)15-5-6-15/h9-11,15,18H,4-8,12H2,1-3H3 |
| InChIKey | JCDYJRJNBOJFCU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |