C14H18Cl2N2 — CID 64924869
3-cyclopropyl-1-(2,5-dichlorophenyl)-3-methylpiperazine (PubChem CID 64924869) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,5-dichlorophenyl)-3-methylpiperazine.
| Compound Name | 3-cyclopropyl-1-(2,5-dichlorophenyl)-3-methylpiperazine |
|---|---|
| PubChem CID | 64924869 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-cyclopropyl-1-(2,5-dichlorophenyl)-3-methylpiperazine |
| SMILES | CC1(C2CC2)CN(c2cc(Cl)ccc2Cl)CCN1 |
| InChI | InChI=1S/C14H18Cl2N2/c1-14(10-2-3-10)9-18(7-6-17-14)13-8-11(15)4-5-12(13)16/h4-5,8,10,17H,2-3,6-7,9H2,1H3 |
| InChIKey | SOOVDRKANOGKRL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |