C13H17Cl2N3 — CID 106890228
2,6-dichloro-1-N-(1-cyclopropylpyrrolidin-3-yl)benzene-1,4-diamine (PubChem CID 106890228) has the molecular formula C13H17Cl2N3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 2,6-dichloro-1-N-(1-cyclopropylpyrrolidin-3-yl)benzene-1,4-diamine.
| Compound Name | 2,6-dichloro-1-N-(1-cyclopropylpyrrolidin-3-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106890228 |
| Molecular Formula | C13H17Cl2N3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2,6-dichloro-1-N-(1-cyclopropylpyrrolidin-3-yl)benzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NC2CCN(C3CC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2N3/c14-11-5-8(16)6-12(15)13(11)17-9-3-4-18(7-9)10-1-2-10/h5-6,9-10,17H,1-4,7,16H2 |
| InChIKey | PWVCCOMKUQCAOQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|