C13H14F4N2 — CID 107643590
1-cyclopropyl-N-(2,3,5,6-tetrafluorophenyl)pyrrolidin-3-amine (PubChem CID 107643590) has the molecular formula C13H14F4N2 and a molecular weight of 274.26 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,3,5,6-tetrafluorophenyl)pyrrolidin-3-amine.
| Compound Name | 1-cyclopropyl-N-(2,3,5,6-tetrafluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 107643590 |
| Molecular Formula | C13H14F4N2 |
| Molecular Weight | 274.26 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-cyclopropyl-N-(2,3,5,6-tetrafluorophenyl)pyrrolidin-3-amine |
| SMILES | Fc1cc(F)c(F)c(NC2CCN(C3CC3)C2)c1F |
| InChI | InChI=1S/C13H14F4N2/c14-9-5-10(15)12(17)13(11(9)16)18-7-3-4-19(6-7)8-1-2-8/h5,7-8,18H,1-4,6H2 |
| InChIKey | ZCASFLXNNHYQID-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|