C15H19BrFN3S — CID 107535298
4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-bromo-3-fluorobenzenecarbothioamide (PubChem CID 107535298) has the molecular formula C15H19BrFN3S and a molecular weight of 372.31 g/mol. Its IUPAC name is 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-bromo-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-bromo-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535298 |
| Molecular Formula | C15H19BrFN3S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 4-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-ylamino)-2-bromo-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NC2CCN3CCCC3C2)c(F)c1Br |
| InChI | InChI=1S/C15H19BrFN3S/c16-13-11(15(18)21)3-4-12(14(13)17)19-9-5-7-20-6-1-2-10(20)8-9/h3-4,9-10,19H,1-2,5-8H2,(H2,18,21) |
| InChIKey | MSLUELZXBIFOCO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|