C13H12BrCl2N — CID 114001599
N-(4-bromo-2,3-dichlorophenyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 114001599) has the molecular formula C13H12BrCl2N and a molecular weight of 333.06 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 114001599 |
| Molecular Formula | C13H12BrCl2N |
| Molecular Weight | 333.06 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | Clc1c(Br)ccc(NC2CC3CC=CC32)c1Cl |
| InChI | InChI=1S/C13H12BrCl2N/c14-9-4-5-10(13(16)12(9)15)17-11-6-7-2-1-3-8(7)11/h1,3-5,7-8,11,17H,2,6H2 |
| InChIKey | ZTASSAJQSMRDIG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|