C9H11N3S — CID 107648685
N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648685) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648685 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1,3,4-thiadiazol-2-amine |
| SMILES | C1=CC2C(C1)CC2Nc1nncs1 |
| InChI | InChI=1S/C9H11N3S/c1-2-6-4-8(7(6)3-1)11-9-12-10-5-13-9/h1,3,5-8H,2,4H2,(H,11,12) |
| InChIKey | JXGFAZDTWKZKJO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|