C10H15N3S — CID 130863721
N-(2-bicyclo[2.2.2]octanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 130863721) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.2]octanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-bicyclo[2.2.2]octanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 130863721 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-(2-bicyclo[2.2.2]octanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1nnc(NC2CC3CCC2CC3)s1 |
| InChI | InChI=1S/C10H15N3S/c1-3-8-4-2-7(1)5-9(8)12-10-13-11-6-14-10/h6-9H,1-5H2,(H,12,13) |
| InChIKey | OULYMJSHFNNHDO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |