C12H19N3S — CID 107648892
N-spiro[4.5]decan-8-yl-1,3,4-thiadiazol-2-amine (PubChem CID 107648892) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is N-spiro[4.5]decan-8-yl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-spiro[4.5]decan-8-yl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648892 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-spiro[4.5]decan-8-yl-1,3,4-thiadiazol-2-amine |
| SMILES | c1nnc(NC2CCC3(CCCC3)CC2)s1 |
| InChI | InChI=1S/C12H19N3S/c1-2-6-12(5-1)7-3-10(4-8-12)14-11-15-13-9-16-11/h9-10H,1-8H2,(H,14,15) |
| InChIKey | BIDNTWVNVBJORL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |