C8H13N3OS — CID 107648933
N-(oxepan-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648933) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is N-(oxepan-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(oxepan-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648933 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | N-(oxepan-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1nnc(NC2CCCOCC2)s1 |
| InChI | InChI=1S/C8H13N3OS/c1-2-7(3-5-12-4-1)10-8-11-9-6-13-8/h6-7H,1-5H2,(H,10,11) |
| InChIKey | JHDYGRCOVYPIPZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |