C7H11N3S2 — CID 107648510
N-(5-methylthiolan-3-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648510) has the molecular formula C7H11N3S2 and a molecular weight of 201.32 g/mol. Its IUPAC name is N-(5-methylthiolan-3-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(5-methylthiolan-3-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648510 |
| Molecular Formula | C7H11N3S2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | N-(5-methylthiolan-3-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC1CC(Nc2nncs2)CS1 |
| InChI | InChI=1S/C7H11N3S2/c1-5-2-6(3-11-5)9-7-10-8-4-12-7/h4-6H,2-3H2,1H3,(H,9,10) |
| InChIKey | WHQGNNSEJLTIOR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |