C10H16N2S2 — CID 130913730
4,5-dimethyl-N-(5-methylthiolan-3-yl)-1,3-thiazol-2-amine (PubChem CID 130913730) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is 4,5-dimethyl-N-(5-methylthiolan-3-yl)-1,3-thiazol-2-amine.
| Compound Name | 4,5-dimethyl-N-(5-methylthiolan-3-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 130913730 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 4,5-dimethyl-N-(5-methylthiolan-3-yl)-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NC2CSC(C)C2)sc1C |
| InChI | InChI=1S/C10H16N2S2/c1-6-4-9(5-13-6)12-10-11-7(2)8(3)14-10/h6,9H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | JRTKHMLPRODEKU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |