C8H13N3S2 — CID 107648654
N-(2-methylthian-3-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 107648654) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is N-(2-methylthian-3-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2-methylthian-3-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 107648654 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-(2-methylthian-3-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC1SCCCC1Nc1nncs1 |
| InChI | InChI=1S/C8H13N3S2/c1-6-7(3-2-4-12-6)10-8-11-9-5-13-8/h5-7H,2-4H2,1H3,(H,10,11) |
| InChIKey | ZZLBQSMSTWYNNZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |