C9H15N3S — CID 64922824
N-(2,3-dimethylcyclopentyl)-1,3,4-thiadiazol-2-amine (PubChem CID 64922824) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2,3-dimethylcyclopentyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 64922824 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC1CCC(Nc2nncs2)C1C |
| InChI | InChI=1S/C9H15N3S/c1-6-3-4-8(7(6)2)11-9-12-10-5-13-9/h5-8H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | UASBVYCWNYWBNY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |