C13H14BrN — CID 43762853
N-(3-bromophenyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 43762853) has the molecular formula C13H14BrN and a molecular weight of 264.17 g/mol. Its IUPAC name is N-(3-bromophenyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(3-bromophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 43762853 |
| Molecular Formula | C13H14BrN |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-(3-bromophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | Brc1cccc(NC2CC3CC=CC32)c1 |
| InChI | InChI=1S/C13H14BrN/c14-10-4-2-5-11(8-10)15-13-7-9-3-1-6-12(9)13/h1-2,4-6,8-9,12-13,15H,3,7H2 |
| InChIKey | ZNPFCEGPOGWBSE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|