C14H15N3 — CID 43790623
N-(6-bicyclo[3.2.0]hept-3-enyl)-1H-indazol-6-amine (PubChem CID 43790623) has the molecular formula C14H15N3 and a molecular weight of 225.30 g/mol. Its IUPAC name is N-(6-bicyclo[3.2.0]hept-3-enyl)-1H-indazol-6-amine.
| Compound Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1H-indazol-6-amine |
|---|---|
| PubChem CID | 43790623 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-(6-bicyclo[3.2.0]hept-3-enyl)-1H-indazol-6-amine |
| SMILES | C1=CC2C(C1)CC2Nc1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C14H15N3/c1-2-9-6-14(12(9)3-1)16-11-5-4-10-8-15-17-13(10)7-11/h1,3-5,7-9,12,14,16H,2,6H2,(H,15,17) |
| InChIKey | VXYZIBFCYPQHSI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|