C13H13BrFN — CID 65437109
N-(4-bromo-3-fluorophenyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 65437109) has the molecular formula C13H13BrFN and a molecular weight of 282.16 g/mol. Its IUPAC name is N-(4-bromo-3-fluorophenyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | N-(4-bromo-3-fluorophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 65437109 |
| Molecular Formula | C13H13BrFN |
| Molecular Weight | 282.16 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | N-(4-bromo-3-fluorophenyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | Fc1cc(NC2CC3CC=CC32)ccc1Br |
| InChI | InChI=1S/C13H13BrFN/c14-11-5-4-9(7-12(11)15)16-13-6-8-2-1-3-10(8)13/h1,3-5,7-8,10,13,16H,2,6H2 |
| InChIKey | DXWJRXYBRGOKPE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|