C18H20Br2N2 — CID 12024701
trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)cyclohexane-1,2-diamine (PubChem CID 12024701) has the molecular formula C18H20Br2N2 and a molecular weight of 424.18 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 12024701 |
| Molecular Formula | C18H20Br2N2 |
| Molecular Weight | 424.18 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-bis(3-bromophenyl)cyclohexane-1,2-diamine |
| SMILES | Brc1cccc(N[C@@H]2CCCC[C@H]2Nc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C18H20Br2N2/c19-13-5-3-7-15(11-13)21-17-9-1-2-10-18(17)22-16-8-4-6-14(20)12-16/h3-8,11-12,17-18,21-22H,1-2,9-10H2/t17-,18-/m1/s1 |
| InChIKey | IIBCXOUQRVJXLH-QZTJIDSGSA-N |
| XLogP | 6.05 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.18 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |