C18H22N2 — CID 142660752
cis-(1R,2S)-1-N,2-N-diphenylcyclohexane-1,2-diamine (PubChem CID 142660752) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is cis-(1R,2S)-1-N,2-N-diphenylcyclohexane-1,2-diamine.
| Compound Name | cis-(1R,2S)-1-N,2-N-diphenylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 142660752 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | cis-(1R,2S)-1-N,2-N-diphenylcyclohexane-1,2-diamine |
| SMILES | c1ccc(N[C@H]2CCCC[C@H]2Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16/h1-6,9-12,17-20H,7-8,13-14H2/t17-,18+ |
| InChIKey | OWSIQKWSHAQSBW-HDICACEKSA-N |
| XLogP | 4.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |