C16H20N4 — CID 102496168
trans-(1R,2R)-1-N,2-N-dipyridin-4-ylcyclohexane-1,2-diamine (PubChem CID 102496168) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-dipyridin-4-ylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-dipyridin-4-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102496168 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-dipyridin-4-ylcyclohexane-1,2-diamine |
| SMILES | c1cc(N[C@@H]2CCCC[C@H]2Nc2ccncc2)ccn1 |
| InChI | InChI=1S/C16H20N4/c1-2-4-16(20-14-7-11-18-12-8-14)15(3-1)19-13-5-9-17-10-6-13/h5-12,15-16H,1-4H2,(H,17,19)(H,18,20)/t15-,16-/m1/s1 |
| InChIKey | HAONGNSEPSSZSO-HZPDHXFCSA-N |
| XLogP | 3.31 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |