C11H17N3 — CID 61038015
2-N-pyridin-4-ylcyclohexane-1,2-diamine (PubChem CID 61038015) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-N-pyridin-4-ylcyclohexane-1,2-diamine.
| Compound Name | 2-N-pyridin-4-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 61038015 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-N-pyridin-4-ylcyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ccncc1 |
| InChI | InChI=1S/C11H17N3/c12-10-3-1-2-4-11(10)14-9-5-7-13-8-6-9/h5-8,10-11H,1-4,12H2,(H,13,14) |
| InChIKey | WGHJPYSBLSDFEQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |