C18H22N2 — CID 115117777
2-N-(4-phenylphenyl)cyclohexane-1,2-diamine (PubChem CID 115117777) has the molecular formula C18H22N2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-N-(4-phenylphenyl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(4-phenylphenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 115117777 |
| Molecular Formula | C18H22N2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-N-(4-phenylphenyl)cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2/c19-17-8-4-5-9-18(17)20-16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-3,6-7,10-13,17-18,20H,4-5,8-9,19H2 |
| InChIKey | CPRXCGQTZJFNGT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |