C16H24N2 — CID 86338512
N-[(1R,2S)-2-piperidin-1-ylcyclopentyl]aniline (PubChem CID 86338512) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[(1R,2S)-2-piperidin-1-ylcyclopentyl]aniline.
| Compound Name | N-[(1R,2S)-2-piperidin-1-ylcyclopentyl]aniline |
|---|---|
| PubChem CID | 86338512 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[(1R,2S)-2-piperidin-1-ylcyclopentyl]aniline |
| SMILES | c1ccc(N[C@@H]2CCC[C@@H]2N2CCCCC2)cc1 |
| InChI | InChI=1S/C16H24N2/c1-3-8-14(9-4-1)17-15-10-7-11-16(15)18-12-5-2-6-13-18/h1,3-4,8-9,15-17H,2,5-7,10-13H2/t15-,16+/m1/s1 |
| InChIKey | VFIXTSQXHNWTRH-CVEARBPZSA-N |
| XLogP | 3.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |