C23H31N2OP — CID 71507056
trans-(1R,2R)-N-diphenylphosphoryl-2-piperidin-1-ylcyclohexan-1-amine (PubChem CID 71507056) has the molecular formula C23H31N2OP and a molecular weight of 382.49 g/mol. Its IUPAC name is trans-(1R,2R)-N-diphenylphosphoryl-2-piperidin-1-ylcyclohexan-1-amine.
| Compound Name | trans-(1R,2R)-N-diphenylphosphoryl-2-piperidin-1-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 71507056 |
| Molecular Formula | C23H31N2OP |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | trans-(1R,2R)-N-diphenylphosphoryl-2-piperidin-1-ylcyclohexan-1-amine |
| SMILES | O=P(N[C@@H]1CCCC[C@H]1N1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N2OP/c26-27(20-12-4-1-5-13-20,21-14-6-2-7-15-21)24-22-16-8-9-17-23(22)25-18-10-3-11-19-25/h1-2,4-7,12-15,22-23H,3,8-11,16-19H2,(H,24,26)/t22-,23-/m1/s1 |
| InChIKey | RMFHCVDPTHDALA-DHIUTWEWSA-N |
| XLogP | 4.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|