C30H32N2P2S2 — CID 102079929
trans-(1S,2S)-1-N,2-N-bis(diphenylphosphinothioyl)cyclohexane-1,2-diamine (PubChem CID 102079929) has the molecular formula C30H32N2P2S2 and a molecular weight of 546.68 g/mol. Its IUPAC name is trans-(1S,2S)-1-N,2-N-bis(diphenylphosphinothioyl)cyclohexane-1,2-diamine.
| Compound Name | trans-(1S,2S)-1-N,2-N-bis(diphenylphosphinothioyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102079929 |
| Molecular Formula | C30H32N2P2S2 |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | trans-(1S,2S)-1-N,2-N-bis(diphenylphosphinothioyl)cyclohexane-1,2-diamine |
| SMILES | S=P(N[C@H]1CCCC[C@@H]1NP(=S)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N2P2S2/c35-33(25-15-5-1-6-16-25,26-17-7-2-8-18-26)31-29-23-13-14-24-30(29)32-34(36,27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22,29-30H,13-14,23-24H2,(H,31,35)(H,32,36)/t29-,30-/m0/s1 |
| InChIKey | AJEQCKWWYJOAJP-KYJUHHDHSA-N |
| XLogP | 5.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|