C44H40N2O4P2 — CID 100933455
2-diphenylphosphoryl-N-[(1R,2R)-2-[(2-diphenylphosphorylbenzoyl)amino]cyclohexyl]benzamide (PubChem CID 100933455) has the molecular formula C44H40N2O4P2 and a molecular weight of 722.76 g/mol. Its IUPAC name is 2-diphenylphosphoryl-N-[(1R,2R)-2-[(2-diphenylphosphorylbenzoyl)amino]cyclohexyl]benzamide.
| Compound Name | 2-diphenylphosphoryl-N-[(1R,2R)-2-[(2-diphenylphosphorylbenzoyl)amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 100933455 |
| Molecular Formula | C44H40N2O4P2 |
| Molecular Weight | 722.76 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 2-diphenylphosphoryl-N-[(1R,2R)-2-[(2-diphenylphosphorylbenzoyl)amino]cyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1NC(=O)c1ccccc1P(=O)(c1ccccc1)c1ccccc1)c1ccccc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H40N2O4P2/c47-43(37-27-13-17-31-41(37)51(49,33-19-5-1-6-20-33)34-21-7-2-8-22-34)45-39-29-15-16-30-40(39)46-44(48)38-28-14-18-32-42(38)52(50,35-23-9-3-10-24-35)36-25-11-4-12-26-36/h1-14,17-28,31-32,39-40H,15-16,29-30H2,(H,45,47)(H,46,48)/t39-,40-/m1/s1 |
| InChIKey | FNNOPARCCINQKS-XRSDMRJBSA-N |
| XLogP | 6.44 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.76 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|