C18H21OPS2 — CID 101201910
trans-(1S,2S)-2-diphenylphosphinothioylsulfanylcyclohexan-1-ol (PubChem CID 101201910) has the molecular formula C18H21OPS2 and a molecular weight of 348.47 g/mol. Its IUPAC name is trans-(1S,2S)-2-diphenylphosphinothioylsulfanylcyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-diphenylphosphinothioylsulfanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 101201910 |
| Molecular Formula | C18H21OPS2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | trans-(1S,2S)-2-diphenylphosphinothioylsulfanylcyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1SP(=S)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21OPS2/c19-17-13-7-8-14-18(17)22-20(21,15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17-19H,7-8,13-14H2/t17-,18-/m0/s1 |
| InChIKey | BVDSHUVTZQLLNJ-ROUUACIJSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|