C18H23N5 — CID 154866863
N-(4-phenyl-1,3,5-triazin-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-amine (PubChem CID 154866863) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is N-(4-phenyl-1,3,5-triazin-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-amine.
| Compound Name | N-(4-phenyl-1,3,5-triazin-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-amine |
|---|---|
| PubChem CID | 154866863 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N-(4-phenyl-1,3,5-triazin-2-yl)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-amine |
| SMILES | c1ccc(-c2ncnc(NC3CCCN4CCCCC34)n2)cc1 |
| InChI | InChI=1S/C18H23N5/c1-2-7-14(8-3-1)17-19-13-20-18(22-17)21-15-9-6-12-23-11-5-4-10-16(15)23/h1-3,7-8,13,15-16H,4-6,9-12H2,(H,19,20,21,22) |
| InChIKey | ZIWJRTOBJXOHOZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |