C14H15N5O — CID 167750402
(3S)-3-[(4-phenyl-1,3,5-triazin-2-yl)amino]piperidin-2-one (PubChem CID 167750402) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is (3S)-3-[(4-phenyl-1,3,5-triazin-2-yl)amino]piperidin-2-one.
| Compound Name | (3S)-3-[(4-phenyl-1,3,5-triazin-2-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 167750402 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (3S)-3-[(4-phenyl-1,3,5-triazin-2-yl)amino]piperidin-2-one |
| SMILES | O=C1NCCC[C@@H]1Nc1ncnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H15N5O/c20-13-11(7-4-8-15-13)18-14-17-9-16-12(19-14)10-5-2-1-3-6-10/h1-3,5-6,9,11H,4,7-8H2,(H,15,20)(H,16,17,18,19)/t11-/m0/s1 |
| InChIKey | HIFYTPGLGPMPAL-NSHDSACASA-N |
| XLogP | 1.23 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |