C14H15FN6O — CID 138022815
4-[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]piperazine-1-carboxamide (PubChem CID 138022815) has the molecular formula C14H15FN6O and a molecular weight of 302.31 g/mol. Its IUPAC name is 4-[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 138022815 |
| Molecular Formula | C14H15FN6O |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-[4-(3-fluorophenyl)-1,3,5-triazin-2-yl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ncnc(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C14H15FN6O/c15-11-3-1-2-10(8-11)12-17-9-18-14(19-12)21-6-4-20(5-7-21)13(16)22/h1-3,8-9H,4-7H2,(H2,16,22) |
| InChIKey | ORIQOJRFULBOER-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |