C18H23N9O2 — CID 118132495
4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazine-1-carboxamide (PubChem CID 118132495) has the molecular formula C18H23N9O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazine-1-carboxamide.
| Compound Name | 4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 118132495 |
| Molecular Formula | C18H23N9O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 4-[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(c2ncc(-c3cccc(CNC(=O)N=C(N)N)c3)cn2)CC1 |
| InChI | InChI=1S/C18H23N9O2/c19-15(20)25-18(29)24-9-12-2-1-3-13(8-12)14-10-22-17(23-11-14)27-6-4-26(5-7-27)16(21)28/h1-3,8,10-11H,4-7,9H2,(H2,21,28)(H5,19,20,24,25,29) |
| InChIKey | LIVXAYBPFFLWKT-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 168.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|