C20H27N7O2 — CID 118132407
1-(diaminomethylidene)-3-[[3-[2-[3-(methoxymethyl)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea (PubChem CID 118132407) has the molecular formula C20H27N7O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-[[3-[2-[3-(methoxymethyl)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea.
| Compound Name | 1-(diaminomethylidene)-3-[[3-[2-[3-(methoxymethyl)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 118132407 |
| Molecular Formula | C20H27N7O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 1-(diaminomethylidene)-3-[[3-[2-[3-(methoxymethyl)piperidin-1-yl]pyrimidin-5-yl]phenyl]methyl]urea |
| SMILES | COCC1CCCN(c2ncc(-c3cccc(CNC(=O)N=C(N)N)c3)cn2)C1 |
| InChI | InChI=1S/C20H27N7O2/c1-29-13-15-5-3-7-27(12-15)19-23-10-17(11-24-19)16-6-2-4-14(8-16)9-25-20(28)26-18(21)22/h2,4,6,8,10-11,15H,3,5,7,9,12-13H2,1H3,(H5,21,22,25,26,28) |
| InChIKey | KRXVMVQOUOYWMQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|