C24H26N4O2 — CID 95085955
(3S)-N-[(3-methoxyphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 95085955) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is (3S)-N-[(3-methoxyphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-methoxyphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95085955 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (3S)-N-[(3-methoxyphenyl)methyl]-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@H]2CCCN(c3ncc(-c4ccccc4)cn3)C2)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-30-22-11-5-7-18(13-22)14-25-23(29)20-10-6-12-28(17-20)24-26-15-21(16-27-24)19-8-3-2-4-9-19/h2-5,7-9,11,13,15-16,20H,6,10,12,14,17H2,1H3,(H,25,29)/t20-/m0/s1 |
| InChIKey | QBWAZJXCPPWVDB-FQEVSTJZSA-N |
| XLogP | 3.68 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |