C24H26N4O3 — CID 95085904
(3R)-N-(3,5-dimethoxyphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 95085904) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (3R)-N-(3,5-dimethoxyphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3,5-dimethoxyphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95085904 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (3R)-N-(3,5-dimethoxyphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2CCCN(c3ncc(-c4ccccc4)cn3)C2)cc(OC)c1 |
| InChI | InChI=1S/C24H26N4O3/c1-30-21-11-20(12-22(13-21)31-2)27-23(29)18-9-6-10-28(16-18)24-25-14-19(15-26-24)17-7-4-3-5-8-17/h3-5,7-8,11-15,18H,6,9-10,16H2,1-2H3,(H,27,29)/t18-/m1/s1 |
| InChIKey | AULJHEGGNZXHLJ-GOSISDBHSA-N |
| XLogP | 4.02 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |