C23H23ClN4O — CID 95085857
(3S)-N-(3-chloro-4-methylphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide (PubChem CID 95085857) has the molecular formula C23H23ClN4O and a molecular weight of 406.92 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-methylphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chloro-4-methylphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95085857 |
| Molecular Formula | C23H23ClN4O |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (3S)-N-(3-chloro-4-methylphenyl)-1-(5-phenylpyrimidin-2-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCCN(c3ncc(-c4ccccc4)cn3)C2)cc1Cl |
| InChI | InChI=1S/C23H23ClN4O/c1-16-9-10-20(12-21(16)24)27-22(29)18-8-5-11-28(15-18)23-25-13-19(14-26-23)17-6-3-2-4-7-17/h2-4,6-7,9-10,12-14,18H,5,8,11,15H2,1H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | BESCZRHHAMPIIZ-SFHVURJKSA-N |
| XLogP | 4.96 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |