C27H32N8O3 — CID 118132400
ethyl 4-[4-[[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]amino]piperidin-1-yl]benzoate (PubChem CID 118132400) has the molecular formula C27H32N8O3 and a molecular weight of 516.61 g/mol. Its IUPAC name is ethyl 4-[4-[[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]amino]piperidin-1-yl]benzoate.
| Compound Name | ethyl 4-[4-[[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]amino]piperidin-1-yl]benzoate |
|---|---|
| PubChem CID | 118132400 |
| Molecular Formula | C27H32N8O3 |
| Molecular Weight | 516.61 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | ethyl 4-[4-[[5-[3-[(diaminomethylidenecarbamoylamino)methyl]phenyl]pyrimidin-2-yl]amino]piperidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2CCC(Nc3ncc(-c4cccc(CNC(=O)N=C(N)N)c4)cn3)CC2)cc1 |
| InChI | InChI=1S/C27H32N8O3/c1-2-38-24(36)19-6-8-23(9-7-19)35-12-10-22(11-13-35)33-26-30-16-21(17-31-26)20-5-3-4-18(14-20)15-32-27(37)34-25(28)29/h3-9,14,16-17,22H,2,10-13,15H2,1H3,(H,30,31,33)(H5,28,29,32,34,37) |
| InChIKey | UGPFFTBJHWEAET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|